N-(7-chloro-6-oxoheptyl)-4-methylbenzenesulfonamide structure
|
Common Name | N-(7-chloro-6-oxoheptyl)-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 72676-79-0 | Molecular Weight | 317.83200 | |
| Density | 1.204g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | N-(7-chloro-6-oxoheptyl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.83200 |
| Flash Point | 243.5ºC |
| Exact Mass | 317.08500 |
| PSA | 71.62000 |
| LogP | 4.11330 |
| Index of Refraction | 1.527 |
| InChIKey | APAHKELLCHULLY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCCC(=O)CCl)cc1 |
|
~%
N-(7-chloro-6-o... CAS#:72676-79-0 |
| Literature: Sajadi; Kashani; Loeffler; Hall Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 275 - 278 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-(N-Tosyl)aminocaproic acid chloromethyl ketone |
| Benzenesulfonamide,N-(7-chloro-6-oxoheptyl)-4-methyl |