2H-Indol-2-one,1,3-dihydro-3-(2-oxocyclohexylidene)- structure
|
Common Name | 2H-Indol-2-one,1,3-dihydro-3-(2-oxocyclohexylidene)- | ||
|---|---|---|---|---|
| CAS Number | 72677-37-3 | Molecular Weight | 227.25900 | |
| Density | 1.284g/cm3 | Boiling Point | 433.2ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.1ºC | |
| Name | (3Z)-3-(2-oxocyclohexylidene)-1H-indol-2-one |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 433.2ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 183.1ºC |
| Exact Mass | 227.09500 |
| PSA | 46.17000 |
| LogP | 2.67340 |
| Index of Refraction | 1.627 |
| InChIKey | JDITXCAQYYUTET-RAXLEYEMSA-N |
| SMILES | O=C1CCCCC1=C1C(=O)Nc2ccccc21 |
|
~79%
2H-Indol-2-one,... CAS#:72677-37-3 |
| Literature: Joshi, Krishna C.; Dandia, Anshu; Sanan, Sangeeta Journal of Fluorine Chemistry, 1989 , vol. 44, p. 59 - 72 |
|
~%
2H-Indol-2-one,... CAS#:72677-37-3 |
| Literature: Joshi, Krishna C.; Dandia, Anshu; Sanan, Sangeeta Journal of Fluorine Chemistry, 1989 , vol. 44, p. 59 - 72 |
|
~%
2H-Indol-2-one,... CAS#:72677-37-3 |
| Literature: Joshi, Krishna C.; Dandia, Anshu; Sanan, Sangeeta Journal of Fluorine Chemistry, 1989 , vol. 44, p. 59 - 72 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |