Bicyclo[2.2.1]heptane-2-carbonyl chloride, 4,7,7-trimethyl-3-oxo-, (1R)- (9CI) structure
|
Common Name | Bicyclo[2.2.1]heptane-2-carbonyl chloride, 4,7,7-trimethyl-3-oxo-, (1R)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 72690-88-1 | Molecular Weight | 214.68900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15ClO2 |
|---|---|
| Molecular Weight | 214.68900 |
| Exact Mass | 214.07600 |
| PSA | 34.14000 |
| LogP | 2.39320 |
| InChIKey | BJFLBFJZUJVICY-JYHQXFQUSA-N |
| SMILES | CC12CCC(C(C(=O)Cl)C1=O)C2(C)C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Bicyclo[2.2.1]heptane-2-carbonyl chloride,4,7,7-trimethyl-3-oxo-,(1R)-(9CI) |