4,4'-DIAZIDODIPHENYL ETHANE structure
|
Common Name | 4,4'-DIAZIDODIPHENYL ETHANE | ||
|---|---|---|---|---|
| CAS Number | 72695-23-9 | Molecular Weight | 264.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-azido-4-[2-(4-azidophenyl)ethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N6 |
|---|---|
| Molecular Weight | 264.28500 |
| Exact Mass | 264.11200 |
| PSA | 99.50000 |
| LogP | 4.26092 |
| InChIKey | XWOUTRFQXXRCIU-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(CCc2ccc(N=[N+]=[N-])cc2)cc1 |
| HS Code | 2929909090 |
|---|
|
~82%
4,4'-DIAZIDODIP... CAS#:72695-23-9 |
| Literature: THE SECRETARY OF STATE FOR DEFENCE Patent: WO2005/28423 A2, 2005 ; Location in patent: Page/Page column 28 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| BIPA120 |
| 4,4'-ethylene-1,1'-diphenylazide |
| 4,4'-Diazidodiphenyl ethane |