compound 78-265
Modify Date: 2025-08-25 05:35:55
compound 78-265 structure
|
Common Name | compound 78-265 | ||
|---|---|---|---|---|
| CAS Number | 72699-06-0 | Molecular Weight | 450.46700 | |
| Density | 2.02g/cm3 | Boiling Point | 448.8ºC at 760 mmHg | |
| Molecular Formula | C13H7Br2ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | 3,5-dibromo-N-(4-chloro-3-nitrophenyl)-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760 mmHg |
| Molecular Formula | C13H7Br2ClN2O4 |
| Molecular Weight | 450.46700 |
| Flash Point | 225.2ºC |
| Exact Mass | 447.84600 |
| PSA | 98.64000 |
| LogP | 5.63830 |
| Index of Refraction | 1.736 |
| InChIKey | JFYGKHWLKQBUJI-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)c1cc(Br)cc(Br)c1O |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:72670-72-5| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Compound 78-265 |
| 3,5-Dibromo-N-(4-chloro-3-nitrophenyl)salicylamide |
| 3,5-Dibrom-4'-chlor-3'-nitrosalicylanilid |
| 3,5-dibromo-N-(4-chloro-3-nitro-phenyl)-2-hydroxy-benzamide |