plicatin B structure
|
Common Name | plicatin B | ||
|---|---|---|---|---|
| CAS Number | 72704-01-9 | Molecular Weight | 246.30200 | |
| Density | 1.096g/cm3 | Boiling Point | 371.1ºC at 760 mmHg | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.1ºC | |
| Name | methyl (E)-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 371.1ºC at 760 mmHg |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.30200 |
| Flash Point | 151.1ºC |
| Exact Mass | 246.12600 |
| PSA | 46.53000 |
| LogP | 3.08710 |
| Index of Refraction | 1.57 |
| InChIKey | LZEOAWXRNGQEHO-RMKNXTFCSA-N |
| SMILES | COC(=O)C=Cc1ccc(O)c(CC=C(C)C)c1 |
| HS Code | 2918199090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Propenoic acid,3-(4-hydroxy-3-(3-methyl-2-butenyl)phenyl)-,methyl ester,(E) |
| Plicatin B |
| Methyl 3-(4-hydroxy-3-(3-methyl-2-butenyl)phenyl)-2-propenoate |
| methyl (E)-3-[4-hydroxy-3-(3-methylbutenyl)phenyl]-2-propenate |
| methyl (E)-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]acrylate |
| Methyl (E)-3-(4-hydroxy-3-(3-methyl-2-butenyl)phenyl)-2-propenoate |
| (E)-methyl 3-[4-Hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]acrylate |