4-P-TOLYL[1,2,4]TRIAZOLE-3,5-DIONE structure
|
Common Name | 4-P-TOLYL[1,2,4]TRIAZOLE-3,5-DIONE | ||
|---|---|---|---|---|
| CAS Number | 72708-83-9 | Molecular Weight | 189.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7N3O2 |
|---|---|
| Molecular Weight | 189.17100 |
| Exact Mass | 189.05400 |
| PSA | 62.10000 |
| LogP | 1.44340 |
| InChIKey | ZQMWFABJLXYBSW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)N=NC2=O)cc1 |
|
~%
4-P-TOLYL[1,2,4... CAS#:72708-83-9 |
| Literature: Adam,W.; Carballeira,N. Journal of the American Chemical Society, 1984 , vol. 106, p. 2874 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(4-methylphenyl)triazolinedione |
| 4-p-tolyl-1,2,4-triazoline-3,5-dione |
| 4-(p-methylphenyl)-1,2,4-triazoline-3,5-dione |
| 4-p-tolyl[1,2,4]triazole-3,5-dione |
| 4-(4-Methylphenyl)-1,2,4-triazoline-3,5-dione |
| 4-p-Tolyl-3H-1,2,4-triazol-3,5(4H)-dion |
| 3H-1,2,4-Triazole-3,5(4H)-dione,4-(4-methylphenyl) |
| 4-p-tolyl-1,2,4-triazolinedione |