2,6,10,14-tetramethylhexadecan-1-ol structure
|
Common Name | 2,6,10,14-tetramethylhexadecan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 72720-15-1 | Molecular Weight | 298.54700 | |
| Density | 0.834g/cm3 | Boiling Point | 343.6ºC at 760 mmHg | |
| Molecular Formula | C20H42O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.3ºC | |
| Name | 2,6,10,14-tetramethylhexadecan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.834g/cm3 |
|---|---|
| Boiling Point | 343.6ºC at 760 mmHg |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.54700 |
| Flash Point | 154.3ºC |
| Exact Mass | 298.32400 |
| PSA | 20.23000 |
| LogP | 6.44400 |
| Index of Refraction | 1.449 |
| InChIKey | MCLAAIPWDRUBAZ-UHFFFAOYSA-N |
| SMILES | CCC(C)CCCC(C)CCCC(C)CCCC(C)CO |
|
~%
2,6,10,14-tetra... CAS#:72720-15-1 |
| Literature: Nakajima, Kenji; Sato, Akio; Takahara, Yoshimasa; Iida, Takeo Agricultural and Biological Chemistry, 1985 , vol. 49, # 7 p. 1993 - 2002 |
|
~%
2,6,10,14-tetra... CAS#:72720-15-1 |
| Literature: Nakajima, Kenji; Sato, Akio; Takahara, Yoshimasa; Iida, Takeo Agricultural and Biological Chemistry, 1985 , vol. 49, # 7 p. 1993 - 2002 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,6,10,14-tetramethyl-1-hexadecanol |
| 2.6.10.14-Tetramethyl-hexadecanol-(1) |
| 1-Hexadecanol,2,6,10,14-tetramethyl |