3,3-dichloro-N-acetylbenzidine structure
|
Common Name | 3,3-dichloro-N-acetylbenzidine | ||
|---|---|---|---|---|
| CAS Number | 72732-23-1 | Molecular Weight | 297.18000 | |
| Density | 1.379g/cm3 | Boiling Point | 488.4ºC at 760 mmHg | |
| Molecular Formula | C14H14Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.2ºC | |
| Name | N-[4-(4-aminophenyl)-6,6-dichlorocyclohexa-1,3-dien-1-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 488.4ºC at 760 mmHg |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.18000 |
| Flash Point | 249.2ºC |
| Exact Mass | 296.04800 |
| PSA | 58.61000 |
| LogP | 4.67130 |
| Index of Refraction | 1.661 |
| InChIKey | BATADEFKYVRLOK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(-c2ccc(N)c(Cl)c2)cc1Cl |
|
~%
3,3-dichloro-N-... CAS#:72732-23-1 |
| Literature: Cain; May Journal of the Chemical Society, 1910 , vol. 97, p. 723 |
|
~%
Detail
|
| Literature: Cain; May Journal of the Chemical Society, 1910 , vol. 97, p. 723 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(4'-Amino-3,3'-dichlor-biphenyl-4-yl)-acetamid |
| N-Acetyl-3.3'-dichlor-benzidin |
| 4'-(Acetylamino)-3,3'-dichlorobiphenyl-4-amine |
| N-(4'-amino-3,3'-dichloro-biphenyl-4-yl)-acetamide |
| Acetamide,N-(4'-amino-3,3'-dichloro[1,1'-biphenyl]-4-yl) |
| N-acetyl-3,3'-dichlorobenzidine |