cis-Cyhalothric acid structure
|
Common Name | cis-Cyhalothric acid | ||
|---|---|---|---|---|
| CAS Number | 72748-35-7 | Molecular Weight | 242.623 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 271.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H10ClF3O2 | Melting Point | 107-109ºC | |
| MSDS | N/A | Flash Point | 118.1±27.3 °C | |
| Name | cis-3-(2-Chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 271.6±40.0 °C at 760 mmHg |
| Melting Point | 107-109ºC |
| Molecular Formula | C9H10ClF3O2 |
| Molecular Weight | 242.623 |
| Flash Point | 118.1±27.3 °C |
| Exact Mass | 242.032135 |
| PSA | 37.30000 |
| LogP | 2.44 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | SPVZAYWHHVLPBN-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C=C(Cl)C(F)(F)F)C1C(=O)O |
| Storage condition | Refrigerator |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD04112623 |
| 3-[(1Z)-2-Chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethylcyclopropanecarboxylic acid |
| Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid |