4,4'-bis(4-phenyl-2H-1,2,3-triazol-2-yl)stilbene-2,2'-disulphonic acid, compound with 2,2'-iminodiethanol structure
|
Common Name | 4,4'-bis(4-phenyl-2H-1,2,3-triazol-2-yl)stilbene-2,2'-disulphonic acid, compound with 2,2'-iminodiethanol | ||
|---|---|---|---|---|
| CAS Number | 72749-70-3 | Molecular Weight | 731.79800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H33N7O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxyethylamino)ethanol,5-(4-phenyltriazol-2-yl)-2-[(E)-2-[4-(4-phenyltriazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H33N7O8S2 |
|---|---|
| Molecular Weight | 731.79800 |
| Exact Mass | 731.18300 |
| PSA | 239.41000 |
| LogP | 5.95890 |
| InChIKey | ZVASIHVJEPJUCU-CALJPSDSSA-N |
| SMILES | O=S(=O)(O)c1cc(-n2ncc(-c3ccccc3)n2)ccc1C=Cc1ccc(-n2ncc(-c3ccccc3)n2)cc1S(=O)(=O)O.OCCNCCO |
| EINECS 276-813-1 |
| 4,4'-Bis(4-phenyl-2H-1,2,3-triazol-2-yl)stilbene-2,2'-disulphonic acid,compound with 2,2'-iminodiethanol |
| Benzenesulfonic acid,2,2'-(1,2-ethenediyl)bis(5-(4-phenyl-2H-1,2,3-triazol-2-yl)-,compd. with 2,2'-iminobis(ethanol) (1:) |
| Benzenesulfonic acid,2,2'-(1,2-ethenediyl)bis(5-(4-phenyl-2H-1,2,3-triazol-2-yl)-,compd. with 2,2'-iminobis(ethanol) |