methyl 2-(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)acetate structure
|
Common Name | methyl 2-(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 72766-02-0 | Molecular Weight | 235.23600 | |
| Density | 1.235g/cm3 | Boiling Point | 477.4ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.5ºC | |
| Name | methyl 2-(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 477.4ºC at 760 mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 242.5ºC |
| Exact Mass | 235.08400 |
| PSA | 68.12000 |
| LogP | 0.53470 |
| Index of Refraction | 1.537 |
| InChIKey | HUIXFVSBBMWVRZ-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc2c(c1)C(=O)NCCO2 |
|
~%
methyl 2-(5-oxo... CAS#:72766-02-0 |
| Literature: Shridhar,D.R. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1979 , vol. 17, p. 155 - 157 |
| Methyl(2,3-dihydro-1,4-benzoxazepin-5(4H)-on-7-yl)acetat |
| 1,4-Benzoxazepine-7-acetic acid,2,3,4,5-tetrahydro-5-oxo-,methyl ester |
| (5-oxo-2,3,4,5-tetrahydro-benzo[f][1,4]oxazepin-7-yl)-acetic acid methyl ester |
| Methyl 2,3,4,5-tetrahydro-5-oxo-1,4-benzoxazepine-7-acetate |