2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone
Modify Date: 2026-09-27 16:04:24
![2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone Structure](https://www.chemsrc.com/extcaspic/070/72775-91-8.png)
2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone structure
|
Common Name | 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 72775-91-8 | Molecular Weight | 278.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14O4S |
|---|---|
| Molecular Weight | 278.33 |
| InChIKey | NJJAOZZTWPVIAQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SCC(O)CO)C(=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone? |
| A: SMILES notation of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone is CC1=C(SCC(O)CO)C(=O)c2ccccc2C1=O. |
| Q: What is the molecular formula of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone? |
| A: Molecular formula of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone is C14H14O4S. |
| Q: What is the CAS number of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone? |
| A: CAS number of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone is 72775-91-8. |
| Q: What is the English name of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone? |
| A: The English name of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone is 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone. |
| Q: What is the Chinese name of 72775-91-8? |
| A: Chinese name of 72775-91-8 is 72775-91-8. |
| Q: What is the molecular weight of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone? |
| A: Molecular weight of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone is 278.33. |
| Q: What is the InChIKey of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone? |
| A: InChIKey of 2-[(2,3-Dihydroxypropyl)thio]-3-methyl-1,4-naphthoquinone is NJJAOZZTWPVIAQ-UHFFFAOYSA-N. |