Urea,N-(2-chlorophenyl)-N'-cyclohexyl- structure
|
Common Name | Urea,N-(2-chlorophenyl)-N'-cyclohexyl- | ||
|---|---|---|---|---|
| CAS Number | 72802-44-9 | Molecular Weight | 252.74000 | |
| Density | 1.2g/cm3 | Boiling Point | 356.7ºC at 760mmHg | |
| Molecular Formula | C13H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | 1-(2-chlorophenyl)-3-cyclohexylurea |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 356.7ºC at 760mmHg |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74000 |
| Flash Point | 169.5ºC |
| Exact Mass | 252.10300 |
| PSA | 41.13000 |
| LogP | 4.25810 |
| Index of Refraction | 1.572 |
| InChIKey | KDLPRFSQGBZLFE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1Cl)NC1CCCCC1 |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N-(2-chlor... CAS#:72802-44-9 |
| Literature: Sah Journal of the Chinese Chemical Society (Peking), 1946 , vol. 13, p. 22,26,27 Recueil des Travaux Chimiques des Pays-Bas, 1940 , vol. 59, p. 231,233,234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |