N-benzyl-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine
Modify Date: 2026-03-20 12:26:28
![N-benzyl-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine Structure](https://www.chemsrc.com/extcaspic/130/728024-50-8.png)
N-benzyl-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine structure
|
Common Name | N-benzyl-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 728024-50-8 | Molecular Weight | 331.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine |
|---|
| Molecular Formula | C21H18FN3 |
|---|---|
| Molecular Weight | 331.4 |
| InChIKey | GFBQMQHVBDJXCL-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=C2NCC3=CC=CC=C3)C4=CC=C(C=C4)F)C=C1 |
|
Name: Transactivation of human FXR expressed in human HeLa cells co-expressing BSEP after 2...
Source: ChEMBL
Target: Bile acid receptor
External Id: CHEMBL4040778
|
|
Name: Transactivation of human FXR expressed in human HeLa cells co-expressing BSEP at 3 uM...
Source: ChEMBL
Target: Bile acid receptor
External Id: CHEMBL4040779
|
Total 2, Current Page 1 of 1
1