Benzenepropanoic acid, 2-methyl-4-(phenylmethoxy)-, methyl ester structure
|
Common Name | Benzenepropanoic acid, 2-methyl-4-(phenylmethoxy)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 728038-73-1 | Molecular Weight | 284.35000 | |
| Density | 1.094g/cm3 | Boiling Point | 410.2ºC at 760 mmHg | |
| Molecular Formula | C18H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.9ºC | |
| Name | Benzenepropanoic acid, 2-methyl-4-(phenylmethoxy)-, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760 mmHg |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35000 |
| Flash Point | 173.9ºC |
| Exact Mass | 284.14100 |
| PSA | 35.53000 |
| LogP | 3.67960 |
| Index of Refraction | 1.55 |
| InChIKey | OJIYKYYEVHELNA-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1ccc(OCc2ccccc2)cc1C |
|
~%
Benzenepropanoi... CAS#:728038-73-1 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/63155 A1, 2004 ; Location in patent: Page 54 ; WO 2004/063155 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-(4-benzyloxy-2-methyl-phenyl)-propionic acid methyl ester |
| (2-{4-[(4-chlorophenyl)phenylmethyl]piperazin-1-yl}ethoxy)acetic acid methyl ester |
| methyl-2-[2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetate |
| Cetirizine Methanol Adduct |
| methyl [2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetate |
| Cetirizine Methyl Ester |
| methyl [2-methyl-3-(4-benzyloxy)phenyl]propionate |