Oleoyl Serinol structure
|
Common Name | Oleoyl Serinol | ||
|---|---|---|---|---|
| CAS Number | 72809-08-6 | Molecular Weight | 355.55500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H41NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Oleoyl SerinolOleoyl serinol is an agonist of the cannabinoid receptor GPR119 (EC50, 12 M), and stimulates secretion of GLP-1. |
| Name | N-(1,3-dihydroxypropan-2-yl)octadec-9-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H41NO3 |
|---|---|
| Molecular Weight | 355.55500 |
| Exact Mass | 355.30900 |
| PSA | 73.05000 |
| LogP | 5.33360 |
| InChIKey | LGDVTFHRZXBSJM-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CO)CO |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(oleamido)propane-1,3-diol |
| N-(2-hydroxy-1-(hydroxymethyl)ethyl)-oleoylamide |
| N-oleoyl serinol |
| 9-Octadecenamide,N-[2-hydroxy-1-(hydroxymethyl)ethyl]-,(9Z) |