Atanine structure
|
Common Name | Atanine | ||
|---|---|---|---|---|
| CAS Number | 7282-19-1 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AtanineAtanine is an alkaloid with antiparasitic activity. Atanine can be isolated from medicinal plant, Evodia rutaecarpa[1]. |
| Name | 4-methoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Atanine is an alkaloid with antiparasitic activity. Atanine can be isolated from medicinal plant, Evodia rutaecarpa[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 42.09000 |
| LogP | 3.04540 |
| InChIKey | SPIWINZXMDJUPE-UHFFFAOYSA-N |
| SMILES | COc1c(CC=C(C)C)c(=O)[nH]c2ccccc12 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 4-methoxy-3-(3-methyl-but-2-enyl)-1H-quinolin-2-one |