(4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one structure
|
Common Name | (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one | ||
|---|---|---|---|---|
| CAS Number | 7282-75-9 | Molecular Weight | 253.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO2 |
|---|---|
| Molecular Weight | 253.29 |
| InChIKey | JRHMHWBEVCUAQI-CABCVRRESA-N |
| SMILES | O=C1NC(c2ccccc2)C(c2ccccc2)CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one? |
| A: Molecular formula of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one is C16H15NO2. |
| Q: What is the CAS number of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one? |
| A: CAS number of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one is 7282-75-9. |
| Q: What is the Chinese name of 7282-75-9? |
| A: Chinese name of 7282-75-9 is 7282-75-9. |
| Q: What is the molecular weight of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one? |
| A: Molecular weight of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one is 253.29. |
| Q: What is the InChIKey of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one? |
| A: InChIKey of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one is JRHMHWBEVCUAQI-CABCVRRESA-N. |
| Q: What is the SMILES notation of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one? |
| A: SMILES notation of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one is O=C1NC(c2ccccc2)C(c2ccccc2)CO1. |
| Q: What is the English name of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one? |
| A: The English name of (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one is (4R,5R)-4,5-Diphenyl-1,3-oxazinan-2-one. |