5-Norbornene-2,3-dicarboxylic acid
Modify Date: 2026-06-27 11:27:35
5-Norbornene-2,3-dicarboxylic acid structure
|
Common Name | 5-Norbornene-2,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7288-32-6 | Molecular Weight | 182.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Norbornene-2,3-dicarboxylic acid |
|---|
| Molecular Formula | C9H10O4 |
|---|---|
| Molecular Weight | 182.17 |
| InChIKey | NIDNOXCRFUCAKQ-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C(C2C(=O)O)C(=O)O |
|
Name: Inhibition of Protein Phosphatase 2A (PP2A) partially purified from mouse brain
Source: ChEMBL
Target: N/A
External Id: CHEMBL772562
|
|
Name: Inhibition of Protein Phosphatase 2A (PP2A) (Not determined)
Source: ChEMBL
Target: N/A
External Id: CHEMBL772561
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 5, Current Page 1 of 1
1