5-(3-oxo-3-phenyl-propenyl)-thiophene-2-sulfonyl chloride structure
|
Common Name | 5-(3-oxo-3-phenyl-propenyl)-thiophene-2-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 728864-91-3 | Molecular Weight | 312.79200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-oxo-3-phenyl-propenyl)-thiophene-2-sulfonyl chloride |
|---|
| Molecular Formula | C13H9ClO3S2 |
|---|---|
| Molecular Weight | 312.79200 |
| Exact Mass | 311.96800 |
| PSA | 87.83000 |
| LogP | 4.65250 |
| InChIKey | WMGRSYDWDSOZQG-SOFGYWHQSA-N |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)Cl)s1)c1ccccc1 |
|
~%
5-(3-oxo-3-phen... CAS#:728864-91-3 |
| Literature: El-Sayed, Ragab A. Phosphorus, Sulfur and Silicon and the Related Elements, 2007 , vol. 182, # 5 p. 1143 - 1151 |