3-(2,4-difluorophenyl)benzaldehyde structure
|
Common Name | 3-(2,4-difluorophenyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 728918-77-2 | Molecular Weight | 218.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,4-difluorophenyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8F2O |
|---|---|
| Molecular Weight | 218.19900 |
| Exact Mass | 218.05400 |
| PSA | 17.07000 |
| LogP | 3.44430 |
| InChIKey | JNUHPVIPVHFTRW-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc(-c2ccc(F)cc2F)c1 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2',4'-Difluoro-biphenyl-3-carbaldehyde |
| 3-(2,5-Difluorophenyl)benzaldehyde |
| [1,1'-Biphenyl]-3-carboxaldehyde,2',4'-difluoro |