8-Amino-2,3,6,7-tetrabromo-5-hydroxy-4-iminonaphthalen-1(4H)-one
Modify Date: 2025-11-09 13:20:46
8-Amino-2,3,6,7-tetrabromo-5-hydroxy-4-iminonaphthalen-1(4H)-one structure
|
Common Name | 8-Amino-2,3,6,7-tetrabromo-5-hydroxy-4-iminonaphthalen-1(4H)-one | ||
|---|---|---|---|---|
| CAS Number | 72918-28-6 | Molecular Weight | 503.76700 | |
| Density | 2.74g/cm3 | Boiling Point | 273.2ºC at 760 mmHg | |
| Molecular Formula | C10H4Br4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119ºC | |
| Name | 4,8-diamino-2,3,6,7-tetrabromonaphthalene-1,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.74g/cm3 |
|---|---|
| Boiling Point | 273.2ºC at 760 mmHg |
| Molecular Formula | C10H4Br4N2O2 |
| Molecular Weight | 503.76700 |
| Flash Point | 119ºC |
| Exact Mass | 499.70100 |
| PSA | 86.18000 |
| LogP | 3.98080 |
| Index of Refraction | 1.826 |
| InChIKey | OCJTZMFKNFAESY-UHFFFAOYSA-N |
| SMILES | N=C1C(Br)=C(Br)C(=O)c2c(N)c(Br)c(Br)c(O)c21 |
| HS Code | 2925290090 |
|---|
|
~%
8-Amino-2,3,6,7... CAS#:72918-28-6 |
| Literature: Sandoz Patent: US2553048 , 1949 ; |
|
~%
8-Amino-2,3,6,7... CAS#:72918-28-6 |
| Literature: Sandoz Patent: US2553048 , 1949 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,3,6,7-Tetrabromo-5-amino-8-hydroxynaphthoquinone-1-imine |
| 5-amino-2,3,6,7-tetrabromo-8-hydroxy-[1,4]naphthoquinone-1-imine |
| 5-Amino-2,3,6,7-tetrabrom-8-hydroxy-[1,4]naphthochinon-1-imin |
| 8-Amino-2,3,6,7-tetrabromo-5-hydroxy-4-iminonaphthalen-1(4H)-one |
| 1(4H)-Naphthalenone,8-amino-2,3,6,7-tetrabromo-5-hydroxy-4-imino |