4-propylphenyl trans-4-(4-propylcyclohexyl)benzoate structure
|
Common Name | 4-propylphenyl trans-4-(4-propylcyclohexyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 72928-02-0 | Molecular Weight | 364.52000 | |
| Density | 1.019 g/cm3 | Boiling Point | 491.1ºC at 760 mmHg | |
| Molecular Formula | C25H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | (4-propylphenyl) 4-(4-propylcyclohexyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019 g/cm3 |
|---|---|
| Boiling Point | 491.1ºC at 760 mmHg |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.52000 |
| Flash Point | 207.9ºC |
| Exact Mass | 364.24000 |
| PSA | 26.30000 |
| LogP | 6.93220 |
| Index of Refraction | 1.538 |
| InChIKey | TVAPGSSMRUFIFN-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(OC(=O)c2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-PROPYLPHENYL 4-(TRANS-4-PROPYLCYCLOHEXYL)-BENZOATE |
| EINECS 277-043-9 |
| 4-Propylphenyl trans-4-(4-propylcyclohexyl)benzoate |