5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione
![5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione Structure](https://image.chemsrc.com/caspic/499/7293-30-3.png)
5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione structure
|
Common Name | 5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione | ||
|---|---|---|---|---|
| CAS Number | 7293-30-3 | Molecular Weight | 266.64100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7ClN4O3 |
|---|---|
| Molecular Weight | 266.64100 |
| Exact Mass | 266.02100 |
| PSA | 99.66000 |
| LogP | 1.20450 |
| InChIKey | WLCOGDPXTKQCFC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(O)c(N=Nc2ccc(Cl)cc2)c(=O)[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[(4-Chlorophe... CAS#:7293-30-3 |
| Literature: Beaton, Haydn G.; Willey, Gerald R.; Drew, Michael G. B. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 469 - 472 |
|
~%
5-[(4-Chlorophe... CAS#:7293-30-3 |
| Literature: King et al. Journal of the Chemical Society, 1947 , p. 1247 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: Molecular formula of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is C10H7ClN4O3. |
| Q: What is the Chinese name of 7293-30-3? |
| A: Chinese name of 7293-30-3 is 7293-30-3. |
| Q: What is the LogP of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: LogP of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is 1.20450. |
| Q: What is the polar surface area (PSA) of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: Polar surface area (PSA) of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is 99.66000. |
| Q: What is the molecular weight of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: Molecular weight of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is 266.64100. |
| Q: What is the CAS number of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: CAS number of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is 7293-30-3. |
| Q: What is the InChIKey of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: InChIKey of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is WLCOGDPXTKQCFC-UHFFFAOYSA-N. |
| Q: What is the English name of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: The English name of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en). |
| Q: What are the upstream materials of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: Related upstream materials(CAS) of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en): 67-52-7;106-47-8;17333-85-6. |
| Q: What is the SMILES notation of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en)? |
| A: SMILES notation of 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) is O=c1[nH]c(O)c(N=Nc2ccc(Cl)cc2)c(=O)[nH]1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |