Phosphonium,(2-methyl-9H-fluoren-9-yl)triphenyl-, bromide (1:1) structure
|
Common Name | Phosphonium,(2-methyl-9H-fluoren-9-yl)triphenyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7293-67-6 | Molecular Weight | 521.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H26BrP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methyl-9H-fluoren-9-yl)-triphenylphosphanium,bromide |
|---|
| Molecular Formula | C32H26BrP |
|---|---|
| Molecular Weight | 521.42700 |
| Exact Mass | 520.09600 |
| PSA | 13.59000 |
| LogP | 4.06290 |
| InChIKey | FVMKSFWUNPMQQE-UHFFFAOYSA-M |
| SMILES | Cc1ccc2c(c1)C([P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1-2.[Br-] |
|
~%
Phosphonium,(2-... CAS#:7293-67-6 |
| Literature: Johnson,A.W. et al. Journal of the American Chemical Society, 1966 , vol. 88, # 9 p. 1953 - 1958 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |