Allylpropylmalonylurea structure
|
Common Name | Allylpropylmalonylurea | ||
|---|---|---|---|---|
| CAS Number | 7296-17-5 | Molecular Weight | 210.23000 | |
| Density | 1.108g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-prop-2-enyl-5-propyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23000 |
| Exact Mass | 210.10000 |
| PSA | 75.27000 |
| LogP | 1.37260 |
| Index of Refraction | 1.471 |
| InChIKey | JLGWSCSPIJQFQK-UHFFFAOYSA-N |
| SMILES | C=CCC1(CCC)C(=O)NC(=O)NC1=O |
|
~%
Allylpropylmalo... CAS#:7296-17-5 |
| Literature: Volwiler Journal of the American Chemical Society, 1925 , vol. 47, p. 2239 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Allylpropylmalonylurea |
| 5-allyl-5-propyl-pyrimidine-2,4,6-trione |
| 5-Allyl-5-propylbarbitursaeure |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione (9CI),5-(2-propenyl)-5-propyl |
| Barbituric acid (8CI),5-allyl-5-propyl |
| 5-allyl-5-propyl-barbituric acid |