9ALPHA-HYDROXY-8,13-EPOXY-LABD-14-EN-11-ONE structure
|
Common Name | 9ALPHA-HYDROXY-8,13-EPOXY-LABD-14-EN-11-ONE | ||
|---|---|---|---|---|
| CAS Number | 72963-78-1 | Molecular Weight | 320.46600 | |
| Density | 1.079g/cm3 | Boiling Point | 406.6ºC at 760 mmHg | |
| Molecular Formula | C20H32O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 133.4ºC | |
| Name | (3R,4aR,6aS,10aS,10bS)-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079g/cm3 |
|---|---|
| Boiling Point | 406.6ºC at 760 mmHg |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.46600 |
| Flash Point | 133.4ºC |
| Exact Mass | 320.23500 |
| PSA | 46.53000 |
| LogP | 4.03670 |
| Index of Refraction | 1.54 |
| InChIKey | NDROUXDZPPPVIM-UPWFSPPHSA-N |
| SMILES | C=CC1(C)CC(=O)C2(O)C(C)(CCC3C(C)(C)CCCC32C)O1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 9alpha-Hydroxy-8,13-epoxy-labd-14-en-11-one from Coleus forskohlii |
| 9|A-Hydroxy-8,13-epoxy-labd-14-en-11-one from Coleus forskohlii |