1,8-Dimethyl-2-naphthoic acid
Modify Date: 2026-08-19 11:30:42
1,8-Dimethyl-2-naphthoic acid structure
|
Common Name | 1,8-Dimethyl-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 72976-62-6 | Molecular Weight | 200.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,8-Dimethyl-2-naphthoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O2 |
|---|---|
| Molecular Weight | 200.23 |
| InChIKey | COVKLVRHPUTUSA-UHFFFAOYSA-N |
| SMILES | Cc1cccc2ccc(C(=O)O)c(C)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 72976-62-6? |
| A: Chinese name of 72976-62-6 is 72976-62-6. |
| Q: What is the molecular weight of 1,8-Dimethyl-2-naphthoic acid? |
| A: Molecular weight of 1,8-Dimethyl-2-naphthoic acid is 200.23. |
| Q: What is the SMILES notation of 1,8-Dimethyl-2-naphthoic acid? |
| A: SMILES notation of 1,8-Dimethyl-2-naphthoic acid is Cc1cccc2ccc(C(=O)O)c(C)c12. |
| Q: What is the molecular formula of 1,8-Dimethyl-2-naphthoic acid? |
| A: Molecular formula of 1,8-Dimethyl-2-naphthoic acid is C13H12O2. |
| Q: What is the CAS number of 1,8-Dimethyl-2-naphthoic acid? |
| A: CAS number of 1,8-Dimethyl-2-naphthoic acid is 72976-62-6. |
| Q: What is the English name of 1,8-Dimethyl-2-naphthoic acid? |
| A: The English name of 1,8-Dimethyl-2-naphthoic acid is 1,8-Dimethyl-2-naphthoic acid. |
| Q: What is the InChIKey of 1,8-Dimethyl-2-naphthoic acid? |
| A: InChIKey of 1,8-Dimethyl-2-naphthoic acid is COVKLVRHPUTUSA-UHFFFAOYSA-N. |