(4-carboxyphenyl)azanium,dihydrogen phosphate structure
|
Common Name | (4-carboxyphenyl)azanium,dihydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 72977-18-5 | Molecular Weight | 235.13100 | |
| Density | N/A | Boiling Point | 339.9ºC at 760 mmHg | |
| Molecular Formula | C7H10NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4ºC | |
| Name | (4-carboxyphenyl)azanium,dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 339.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H10NO6P |
| Molecular Weight | 235.13100 |
| Flash Point | 159.4ºC |
| Exact Mass | 235.02500 |
| PSA | 150.89000 |
| LogP | 0.61960 |
| InChIKey | UROGTBVATKRSEE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)O)cc1.O=P(O)(O)O |
|
~%
(4-carboxypheny... CAS#:72977-18-5 |
| Literature: Jackson, Peter; Harris, Robin K. Journal of the Chemical Society, Faraday Transactions, 1995 , vol. 91, # 5 p. 805 - 810 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Amino-benzoesaeure,Phosphat |
| BENZOIC ACID,p-AMINO-,PHOSPHATE |
| 4-Aminobenzoic acid phosphoric acid salt |
| 4-amino-benzoic acid,phosphate |
| (4-carboxyphenyl)azanium |