1-[5-Methoxy-2,4-bis(phenylmethoxy)phenyl]-ethanone structure
|
Common Name | 1-[5-Methoxy-2,4-bis(phenylmethoxy)phenyl]-ethanone | ||
|---|---|---|---|---|
| CAS Number | 7298-22-8 | Molecular Weight | 362.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[5-methoxy-2,4-bis(phenylmethoxy)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H22O4 |
|---|---|
| Molecular Weight | 362.41800 |
| Exact Mass | 362.15200 |
| PSA | 44.76000 |
| LogP | 5.05580 |
| InChIKey | UKVLAHANEXQLKD-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)=O)c(OCc2ccccc2)cc1OCc1ccccc1 |
|
~87%
1-[5-Methoxy-2,... CAS#:7298-22-8 |
| Literature: THE UNIVERSITY COURT OF THE UNIVERSITY OF ST ANDREWS Patent: WO2004/69774 A2, 2004 ; Location in patent: Page 89 ; |
| 2,4-Dibenzyloxy-5-methoxyacetophenone |
| 2,4-Dibenzyloxy-5-methoxy-acetophenon |