4-(4-carboxyphenyl)benzoic acid,ethane-1,2-diol,terephthalic acid structure
|
Common Name | 4-(4-carboxyphenyl)benzoic acid,ethane-1,2-diol,terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 72986-53-9 | Molecular Weight | 470.42500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-carboxyphenyl)benzoic acid,ethane-1,2-diol,terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H22O10 |
|---|---|
| Molecular Weight | 470.42500 |
| Exact Mass | 470.12100 |
| PSA | 189.66000 |
| LogP | 2.80400 |
| InChIKey | RNHZPWUXQCALTF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(C(=O)O)cc2)cc1.O=C(O)c1ccc(C(=O)O)cc1.OCCO |
| (1,1'-Biphenyl)-4,4'-dicarboxylic acid,1,4-benzenedicarboxylic acid,1,2-ethanediol polymer |
| (1,1'-Biphenyl)-4,4'-dicarboxylic acid,polymer with 1,4-benzenedicarboxylic acid and 1,2-ethanediol |