4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione,2-methyloxirane structure
|
Common Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione,2-methyloxirane | ||
|---|---|---|---|---|
| CAS Number | 73003-51-7 | Molecular Weight | 454.55500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione,2-methyloxirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H34O6 |
|---|---|
| Molecular Weight | 454.55500 |
| Exact Mass | 454.23600 |
| PSA | 96.36000 |
| LogP | 4.95100 |
| InChIKey | FOFJMRSRVCWONI-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC1CCCC2C(=O)OC(=O)C12.CC1CO1 |
| 3-Methylhexahydrophthalic anhydride,bisphenol A,propylene oxide polymer |
| 1,3-Isobenzofurandione,hexahydro-4-methyl-,polymer with 4,4'-(1-methylethylidene)bis(phenol) and 2-methyloxirane |
| 1,3-Isobenzofurandione,hexahydro-4-methyl-,polymer with 4,4'-(1-methylethylidene)bis(phenol) and methyloxirane |