1H-Imidazole, 2-(1-chloro-9-phenyl-9H-xanthen-9-yl)- structure
|
Common Name | 1H-Imidazole, 2-(1-chloro-9-phenyl-9H-xanthen-9-yl)- | ||
|---|---|---|---|---|
| CAS Number | 73029-47-7 | Molecular Weight | 358.82000 | |
| Density | 1.341g/cm3 | Boiling Point | 574.4ºC at 760 mmHg | |
| Molecular Formula | C22H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.2ºC | |
| Name | 2-(1-chloro-9-phenylxanthen-9-yl)-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 574.4ºC at 760 mmHg |
| Molecular Formula | C22H15ClN2O |
| Molecular Weight | 358.82000 |
| Flash Point | 301.2ºC |
| Exact Mass | 358.08700 |
| PSA | 37.91000 |
| LogP | 5.55150 |
| Index of Refraction | 1.684 |
| InChIKey | KJVULCUHDXCCAB-UHFFFAOYSA-N |
| SMILES | Clc1cccc2c1C(c1ccccc1)(c1ncc[nH]1)c1ccccc1O2 |
|
~%
1H-Imidazole, 2... CAS#:73029-47-7 |
| Literature: Warner Jr.; Luber Jr.; Zusi Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 11 p. 1453 - 1454 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Chlor-9-(imidazo-2-yl)-9-phenylxanthin |
| 2-(1-chloro-9-phenyl-xanthen-9-yl)-1H-imidazole |
| 2-(1-chloro-9-phenyl-9H-xanthen-9-yl)-1H-imidazole |
| 1H-Imidazole,2-(1-chloro-9-phenyl-9H-xanthen-9-yl) |