3-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)propanamide structure
|
Common Name | 3-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 73073-99-1 | Molecular Weight | 249.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO3 |
|---|---|
| Molecular Weight | 249.30600 |
| Exact Mass | 249.13600 |
| PSA | 51.05000 |
| LogP | 2.96040 |
| InChIKey | AJFSLACTVIYWHG-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)CCc1ccc2c(c1)OCO2 |
|
~97%
3-(1,3-benzodio... CAS#:73073-99-1 |
| Literature: Sondengam, B. Lucas; Fomum, Z. Tanee; Charles, Georges; Akam, T. Mac Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1219 - 1222 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-isobutyl-3-(3,4-methylenedioxyphenyl)propionamide |
| dihydrofagaramide |
| 1,3-Benzodioxole-5-propanamide,N-(2-methylpropyl) |