1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate
1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate structure
|
Common Name | 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 73086-84-7 | Molecular Weight | 437.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24BF4N+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H24BF4N+ |
|---|---|
| Molecular Weight | 437.28000 |
| Exact Mass | 437.19400 |
| PSA | 3.88000 |
| LogP | 7.85600 |
| InChIKey | RSKHJRXEPGZFGM-UHFFFAOYSA-N |
| SMILES | CC(C)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:34075-28-0
CAS#:580-35-8
CAS#:766-79-0
CAS#:1004-14-4
CAS#:52700-12-6
CAS#:2049-66-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-i-propyl-2,4,6-triphenylpyridinium tetrafluoroborate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: CAS number of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is 73086-84-7. |
| Q: What is the SMILES notation of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: SMILES notation of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is CC(C)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F. |
| Q: What are the downstream products of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: Related downstream products(CAS) of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate: 34075-28-0;580-35-8;766-79-0;1004-14-4;52700-12-6;2049-66-3. |
| Q: What is the LogP of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: LogP of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is 7.85600. |
| Q: What is the molecular formula of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: Molecular formula of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is C26H24BF4N+. |
| Q: What is the Chinese name of 73086-84-7? |
| A: Chinese name of 73086-84-7 is 73086-84-7. |
| Q: What is the English name of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: The English name of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate. |
| Q: What is the molecular weight of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: Molecular weight of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is 437.28000. |
| Q: What English synonyms does 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate have? |
| A: English synonyms of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate: 1-i-propyl-2,4,6-triphenylpyridinium tetrafluoroborate. |
| Q: What is the InChIKey of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate? |
| A: InChIKey of 1-isopropyl-2,4,6-triphenylpyridinium tetrafluoroborate is RSKHJRXEPGZFGM-UHFFFAOYSA-N. |