Alloxanthoxyletin
Alloxanthoxyletin structure
|
Common Name | Alloxanthoxyletin | ||
|---|---|---|---|---|
| CAS Number | 731-75-9 | Molecular Weight | 258.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.26900 |
| Exact Mass | 258.08900 |
| PSA | 48.67000 |
| LogP | 2.98580 |
| InChIKey | WTBVBNPZXAQTHI-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(=O)ccc2c2c1C=CC(C)(C)O2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
CAS#:74-88-4
CAS#:108-73-6
CAS#:29373-14-6
CAS#:883-09-0
CAS#:541-47-9
CAS#:7661-00-9This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| UNII-8ZB2VP1WPQ |
| 5-methoxy-2,2-dimethyl-pyrano[2,3-h]chromen-8-one |
| 5-methoxy-2,2-dimethyl-2H-pyrano[2,3-f]chromen-8-one |
| Alloxanthoxyletin |
| 5-Methoxy-2,2-dimethyl-2H-pyrano[2,3-f]chromen-8-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: LogP of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is 2.98580. |
| Q: What is the English name of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: The English name of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one. |
| Q: What is the InChIKey of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: InChIKey of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is WTBVBNPZXAQTHI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: SMILES notation of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is COc1cc2oc(=O)ccc2c2c1C=CC(C)(C)O2. |
| Q: What are the upstream materials of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: Related upstream materials(CAS) of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one: 74-88-4;108-73-6;29373-14-6;883-09-0;541-47-9;7661-00-9. |
| Q: What is the molecular weight of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: Molecular weight of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is 258.26900. |
| Q: What English synonyms does 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one have? |
| A: English synonyms of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one: UNII-8ZB2VP1WPQ, 5-methoxy-2,2-dimethyl-pyrano[2,3-h]chromen-8-one, 5-methoxy-2,2-dimethyl-2H-pyrano[2,3-f]chromen-8-one, Alloxanthoxyletin, 5-Methoxy-2,2-dimethyl-2H-pyrano[2,3-f]chromen-8-on. |
| Q: What is the CAS number of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: CAS number of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is 731-75-9. |
| Q: What is the molecular formula of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: Molecular formula of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is C15H14O4. |
| Q: What is the polar surface area (PSA) of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one? |
| A: Polar surface area (PSA) of 5-methoxy-2,2-dimethylpyrano[2,3-h]chromen-8-one is 48.67000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |