2-amino-3,5,6-trichloro-benzoic acid
2-amino-3,5,6-trichloro-benzoic acid structure
|
Common Name | 2-amino-3,5,6-trichloro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 731007-25-3 | Molecular Weight | 240.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-3,5,6-trichloro-benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4Cl3NO2 |
|---|---|
| Molecular Weight | 240.47100 |
| Exact Mass | 238.93100 |
| PSA | 63.32000 |
| LogP | 3.50840 |
| InChIKey | OOXUHYWLEGRYNO-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(Cl)c(Cl)c1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:636-30-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-3,5,6-trichlor-benzoesaeure |
| 3.5.6-Trichlor-anthranilsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: Polar surface area (PSA) of 2-amino-3,5,6-trichloro-benzoic acid is 63.32000. |
| Q: What is the InChIKey of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: InChIKey of 2-amino-3,5,6-trichloro-benzoic acid is OOXUHYWLEGRYNO-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-amino-3,5,6-trichloro-benzoic acid have? |
| A: English synonyms of 2-amino-3,5,6-trichloro-benzoic acid: 2-Amino-3,5,6-trichlor-benzoesaeure, 3.5.6-Trichlor-anthranilsaeure. |
| Q: What are the downstream products of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: Related downstream products(CAS) of 2-amino-3,5,6-trichloro-benzoic acid: 636-30-6. |
| Q: What is the molecular formula of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: Molecular formula of 2-amino-3,5,6-trichloro-benzoic acid is C7H4Cl3NO2. |
| Q: What is the CAS number of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: CAS number of 2-amino-3,5,6-trichloro-benzoic acid is 731007-25-3. |
| Q: What is the English name of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: The English name of 2-amino-3,5,6-trichloro-benzoic acid is 2-amino-3,5,6-trichloro-benzoic acid. |
| Q: What is the Chinese name of 731007-25-3? |
| A: Chinese name of 731007-25-3 is 731007-25-3. |
| Q: What is the LogP of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: LogP of 2-amino-3,5,6-trichloro-benzoic acid is 3.50840. |
| Q: What is the molecular weight of 2-amino-3,5,6-trichloro-benzoic acid? |
| A: Molecular weight of 2-amino-3,5,6-trichloro-benzoic acid is 240.47100. |