2-Propenamide,N-(2-chlorophenyl)-3-phenyl- structure
|
Common Name | 2-Propenamide,N-(2-chlorophenyl)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 73108-79-9 | Molecular Weight | 257.71500 | |
| Density | 1.267g/cm3 | Boiling Point | 453.2ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | 3-hydroxynaphthalene-2-carboxylic acid(2-chlorophenyl)amide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 453.2ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.71500 |
| Flash Point | 227.9ºC |
| Exact Mass | 257.06100 |
| PSA | 29.10000 |
| LogP | 4.06490 |
| Index of Refraction | 1.673 |
| InChIKey | FKLXMLNUDVRAJG-ZHACJKMWSA-N |
| SMILES | O=C(C=Cc1ccccc1)Nc1ccccc1Cl |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
|
~83%
2-Propenamide,N... CAS#:73108-79-9 |
| Literature: Shi, Zhi-Hao; Li, Nian-Guang; Shi, Qian-Ping; Tang, Hao; Tang, Yu-Ping; Li, Wei; Yin, Lian; Yang, Jian-Ping; Duan, Jin-Ao Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 5 p. 1206 - 1211 |
|
~%
2-Propenamide,N... CAS#:73108-79-9 |
| Literature: Aruna; Kalyanakumar; Ramakrishnan Synthetic Communications, 2001 , vol. 31, # 20 p. 3125 - 3130 |
|
~%
2-Propenamide,N... CAS#:73108-79-9 |
| Literature: Aruna; Kalyanakumar; Ramakrishnan Synthetic Communications, 2001 , vol. 31, # 20 p. 3125 - 3130 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Hydroxy-3-naphthoic Acid 2-Chloroanilide |
| 3-hydroxy-[2]naphthoic acid-(2-chloro-anilide) |
| N-(2-chlorophenyl)-3-phenylacrylamide |
| 3-Hydroxy-[2]naphthoesaeure-(2-chlor-anilid) |
| N-(o-Chlor-phenyl)-cinnamamid |