2-(4-nitrophenyl)-4,7-dihydro-1,3-dioxepine structure
|
Common Name | 2-(4-nitrophenyl)-4,7-dihydro-1,3-dioxepine | ||
|---|---|---|---|---|
| CAS Number | 73150-61-5 | Molecular Weight | 221.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-nitrophenyl)-4,7-dihydro-1,3-dioxepine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO4 |
|---|---|
| Molecular Weight | 221.20900 |
| Exact Mass | 221.06900 |
| PSA | 64.28000 |
| LogP | 2.71960 |
| InChIKey | KXCNHOYLPYRFPT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2OCC=CCO2)cc1 |
|
~93%
2-(4-nitropheny... CAS#:73150-61-5 |
| Literature: Abuzov, B. A.; Klimovitskii, E. N.; Remizov, A. B.; Timirbaev, M. B. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1981 , vol. 30, # 5 p. 794 - 799 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1981 , # 5 p. 1030 - 1036 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-p-nitrophenyl-1,3-dioxacyclohept-5-ene |
| 1,3-Dioxepin,4,7-dihydro-2-(4-nitrophenyl) |