(7E,9E,11E)-Aurocitrin
(7E,9E,11E)-Aurocitrin structure
|
Common Name | (7E,9E,11E)-Aurocitrin | ||
|---|---|---|---|---|
| CAS Number | 73151-59-4 | Molecular Weight | 286.36500 | |
| Density | 1.109g/cm3 | Boiling Point | 462.9ºC at 760 mmHg | |
| Molecular Formula | C18H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.9ºC | |
Summary: 3,6-Dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde (common English name: (7E,9E,11E)-aurocitrin), CAS number: 73151-59-4, molecular formula: C18H22O3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 462.9ºC at 760 mmHg |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.36500 |
| Flash Point | 247.9ºC |
| Exact Mass | 286.15700 |
| PSA | 57.53000 |
| LogP | 4.61620 |
| Index of Refraction | 1.612 |
| InChIKey | XWTZRNKHLOKDOQ-OBWVEWQSSA-N |
| SMILES | CCCCCC=CC=CC=Cc1c(O)ccc(O)c1C=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
|
Name: USP30 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Primary
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: InChIKey of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is XWTZRNKHLOKDOQ-OBWVEWQSSA-N. |
| Q: What is the CAS number of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: CAS number of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is 73151-59-4. |
| Q: What is the LogP of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: LogP of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is 4.61620. |
| Q: What is the molecular weight of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: Molecular weight of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is 286.36500. |
| Q: What is the boiling point of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: Boiling point of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is 462.9ºC at 760 mmHg. |
| Q: What is the English name of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: The English name of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde. |
| Q: What is the molecular formula of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: Molecular formula of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is C18H22O3. |
| Q: What is the polar surface area (PSA) of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: Polar surface area (PSA) of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is 57.53000. |
| Q: What is the SMILES notation of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde? |
| A: SMILES notation of 3,6-dihydroxy-2-[(1E,3E,5E)-undeca-1,3,5-trienyl]benzaldehyde is CCCCCC=CC=CC=Cc1c(O)ccc(O)c1C=O. |
| Q: What is the Chinese name of 73151-59-4? |
| A: Chinese name of 73151-59-4 is 73151-59-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |