bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate
bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate structure
|
Common Name | bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 73159-62-3 | Molecular Weight | 255.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H21N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H21N3O4S |
|---|---|
| Molecular Weight | 255.33500 |
| Exact Mass | 255.12500 |
| PSA | 84.30000 |
| InChIKey | RGKQQGIJWWIRRJ-UHFFFAOYSA-M |
| SMILES | CN(C)C(N(C)C)=[N+](C)C.COS(=O)(=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis(dimethylami... CAS#:73159-62-3 |
| Literature: Kantlehner, Willi; Haug, Erwin; Mergen, Walter W.; Speh, Peter; Maier, Thomas; et al. Liebigs Annalen der Chemie, 1984 , # 1 p. 108 - 126 |
|
~%
bis(dimethylami... CAS#:73159-62-3 |
| Literature: Kantlehner,W. et al. Liebigs Annalen der Chemie, 1979 , p. 2089 - 2095 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N,N',N'-tetramethyl-N'',N''-diethylguanidinium methylsulfate |
| Methanaminium,N-[bis(dimethylamino)methylene]-N-methyl-,methylsulfate |
| hexamethylguanidinium methyl sulfate |
| 1,1,2,2,3,3-Hexamethylguanidinium-methylsulfat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: InChIKey of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is RGKQQGIJWWIRRJ-UHFFFAOYSA-M. |
| Q: What are the upstream materials of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: Related upstream materials(CAS) of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate: 63812-27-1;124-40-3;63812-19-1. |
| Q: What is the molecular weight of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: Molecular weight of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is 255.33500. |
| Q: What is the English name of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: The English name of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate. |
| Q: What is the molecular formula of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: Molecular formula of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is C8H21N3O4S. |
| Q: What English synonyms does bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate have? |
| A: English synonyms of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate: N,N,N',N'-tetramethyl-N'',N''-diethylguanidinium methylsulfate, Methanaminium,N-[bis(dimethylamino)methylene]-N-methyl-,methylsulfate, hexamethylguanidinium methyl sulfate, 1,1,2,2,3,3-Hexamethylguanidinium-methylsulfat. |
| Q: What is the SMILES notation of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: SMILES notation of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is CN(C)C(N(C)C)=[N+](C)C.COS(=O)(=O)[O-]. |
| Q: What is the CAS number of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: CAS number of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is 73159-62-3. |
| Q: What is the Chinese name of 73159-62-3? |
| A: Chinese name of 73159-62-3 is 73159-62-3. |
| Q: What is the polar surface area (PSA) of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate? |
| A: Polar surface area (PSA) of bis(dimethylamino)methylidene-dimethylazanium,methyl sulfate is 84.30000. |