6'-Chloro-1'H-spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one structure
|
Common Name | 6'-Chloro-1'H-spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one | ||
|---|---|---|---|---|
| CAS Number | 731762-03-1 | Molecular Weight | 251.71200 | |
| Density | 1.38g/cm3 | Boiling Point | 543.7ºC at 760 mmHg | |
| Molecular Formula | C12H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.6ºC | |
| Name | 6-chlorospiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 543.7ºC at 760 mmHg |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.71200 |
| Flash Point | 282.6ºC |
| Exact Mass | 251.08300 |
| PSA | 56.65000 |
| LogP | 2.05220 |
| Index of Refraction | 1.648 |
| InChIKey | NLHBAYGLPGIPCY-UHFFFAOYSA-N |
| SMILES | O=C1NC2(CCNCC2)Nc2ccc(Cl)cc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |