1-(4-chlorobut-2-enyl)-2-nitro-benzene
1-(4-chlorobut-2-enyl)-2-nitro-benzene structure
|
Common Name | 1-(4-chlorobut-2-enyl)-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 7318-34-5 | Molecular Weight | 211.64500 | |
| Density | 1.229g/cm3 | Boiling Point | 328.9ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-chlorobut-2-enyl)-2-nitrobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 328.9ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.64500 |
| Flash Point | 152.7ºC |
| Exact Mass | 211.04000 |
| PSA | 45.82000 |
| LogP | 3.45550 |
| Index of Refraction | 1.57 |
| InChIKey | USINZSXYHQJTMS-ONEGZZNKSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CC=CCCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(4-chlorobut-... CAS#:7318-34-5 |
| Literature: Arai, Eri; Tokuyama, Hidetoshi; Linsell, Martin S.; Fukuyama, Tohru Tetrahedron Letters, 1998 , vol. 39, # 1-2 p. 71 - 74 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:150760-45-5
CAS#:201486-54-6
CAS#:79844-33-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: Related upstream materials(CAS) of 1-(4-chlorobut-2-enyl)-2-nitrobenzene: 119-66-4;106-99-0. |
| Q: What is the Chinese name of 7318-34-5? |
| A: Chinese name of 7318-34-5 is 7318-34-5. |
| Q: What is the polar surface area (PSA) of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: Polar surface area (PSA) of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is 45.82000. |
| Q: What is the boiling point of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: Boiling point of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is 328.9ºC at 760 mmHg. |
| Q: What is the molecular weight of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: Molecular weight of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is 211.64500. |
| Q: What is the LogP of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: LogP of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is 3.45550. |
| Q: What is the InChIKey of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: InChIKey of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is USINZSXYHQJTMS-ONEGZZNKSA-N. |
| Q: What are the downstream products of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: Related downstream products(CAS) of 1-(4-chlorobut-2-enyl)-2-nitrobenzene: 150760-45-5;201486-54-6;79844-33-0. |
| Q: What is the English name of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: The English name of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is 1-(4-chlorobut-2-enyl)-2-nitrobenzene. |
| Q: What is the SMILES notation of 1-(4-chlorobut-2-enyl)-2-nitrobenzene? |
| A: SMILES notation of 1-(4-chlorobut-2-enyl)-2-nitrobenzene is O=[N+]([O-])c1ccccc1CC=CCCl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |