6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione
Modify Date: 2026-06-29 14:56:55
![6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione Structure](https://www.chemsrc.com/extcaspic/352/73189-72-7.png)
6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione structure
|
Common Name | 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione | ||
|---|---|---|---|---|
| CAS Number | 73189-72-7 | Molecular Weight | 349.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H15NO2 |
|---|---|
| Molecular Weight | 349.4 |
| InChIKey | FUJLBUFOJYAOQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C(=O)C4=CC=CC=C4C5=CC=CC=C5C3=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione? |
| A: InChIKey of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione is FUJLBUFOJYAOQV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione? |
| A: Molecular formula of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione is C24H15NO2. |
| Q: What is the SMILES notation of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione? |
| A: SMILES notation of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione is C1=CC=C2C(=C1)C=CC=C2N3C(=O)C4=CC=CC=C4C5=CC=CC=C5C3=O. |
| Q: What is the Chinese name of 73189-72-7? |
| A: Chinese name of 73189-72-7 is 73189-72-7. |
| Q: What is the CAS number of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione? |
| A: CAS number of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione is 73189-72-7. |
| Q: What is the English name of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione? |
| A: The English name of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione is 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione. |
| Q: What is the molecular weight of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione? |
| A: Molecular weight of 6-Naphthalen-1-ylbenzo[d][2]benzazepine-5,7-dione is 349.4. |