3-oxo-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carboxylic acid structure
|
Common Name | 3-oxo-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 73198-04-6 | Molecular Weight | 270.28300 | |
| Density | 1.5g/cm3 | Boiling Point | 602.6ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.2ºC | |
| Name | 3-oxo-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carboxylic acid |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 602.6ºC at 760 mmHg |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Flash Point | 318.2ºC |
| Exact Mass | 270.10000 |
| PSA | 73.40000 |
| LogP | 1.77860 |
| Index of Refraction | 1.736 |
| InChIKey | NVWTUEWEKRBVPS-UHFFFAOYSA-N |
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)C2CCC(=O)N12 |
|
~50%
3-oxo-1,2,5,6,1... CAS#:73198-04-6 |
| Literature: Bobbitt, James M.; Willis, John P. Journal of Organic Chemistry, 1980 , vol. 45, # 10 p. 1978 - 1984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |