1-anilino-1-phenylpentan-3-one structure
|
Common Name | 1-anilino-1-phenylpentan-3-one | ||
|---|---|---|---|---|
| CAS Number | 732-68-3 | Molecular Weight | 253.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-anilino-1-phenylpentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO |
|---|---|
| Molecular Weight | 253.33900 |
| Exact Mass | 253.14700 |
| PSA | 29.10000 |
| LogP | 4.28200 |
| InChIKey | HISLGTCKKMMTCF-UHFFFAOYSA-N |
| SMILES | CCC(=O)CC(Nc1ccccc1)c1ccccc1 |
|
~89%
1-anilino-1-phe... CAS#:732-68-3 |
| Literature: Manabe, Kei; Mori, Yuichiro; Kobayashi, Shu Tetrahedron, 2001 , vol. 57, # 13 p. 2537 - 2544 |
|
~70%
1-anilino-1-phe... CAS#:732-68-3 |
| Literature: x Tetrahedron, 2002 , vol. 58, # 5 p. 983 - 988 |
|
~64%
1-anilino-1-phe... CAS#:732-68-3 |
| Literature: Jia, Xiao-Dong; Wang, Xiao-E.; Yang, Cai-Xia; Huo, Cong-De; Wang, Wen-Juan; Ren, Yan; Wang, Xi-Cun Organic Letters, 2010 , vol. 12, # 4 p. 732 - 735 |
|
~%
1-anilino-1-phe... CAS#:732-68-3 |
| Literature: Snyder; Kornberg; Romig Journal of the American Chemical Society, 1939 , vol. 61, p. 3556 |
| 1-anilino-1-phenyl-pentan-3-one |
| 5-[(phenyl)(phenylamino)]pentan-3-one |
| 1-phenyl-1-(phenylamino)pentan-3-one |
| 1-phenyl-1-phenylamino-3-pentanone |
| 3-Pentanone,1-phenyl-1-(phenylamino) |
| 5-aminophenyl-5-phenylpentan-3-one |
| 1-Anilino-1-phenyl-pentan-3-on |