2-Butenoic acid,3-[1,1'-biphenyl]-4-yl structure
|
Common Name | 2-Butenoic acid,3-[1,1'-biphenyl]-4-yl | ||
|---|---|---|---|---|
| CAS Number | 7320-83-4 | Molecular Weight | 238.28100 | |
| Density | 1.133g/cm3 | Boiling Point | 410.8ºC at 760 mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.1ºC | |
| Name | (E)-3-(4-phenylphenyl)but-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 410.8ºC at 760 mmHg |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Flash Point | 306.1ºC |
| Exact Mass | 238.09900 |
| PSA | 37.30000 |
| LogP | 3.84150 |
| Index of Refraction | 1.596 |
| InChIKey | ZNIHYWBWYANARQ-VAWYXSNFSA-N |
| SMILES | CC(=CC(=O)O)c1ccc(-c2ccccc2)cc1 |
|
~%
2-Butenoic acid... CAS#:7320-83-4 |
| Literature: Bergmann et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1612,1614 |
|
~%
2-Butenoic acid... CAS#:7320-83-4 |
| Literature: Bergmann et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1612,1614 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-p-phenylzimtsaeure |
| 3-biphenyl-4-yl-crotonic acid |
| 3-Biphenyl-4-yl-crotonsaeure |