3-(3-CHLORO-3-BUTENYL)BENZOIC ACID structure
|
Common Name | 3-(3-CHLORO-3-BUTENYL)BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 732249-18-2 | Molecular Weight | 210.65700 | |
| Density | 1.21g/cm3 | Boiling Point | 350.8ºC at 760 mmHg | |
| Molecular Formula | C11H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
| Name | 3-(3-chlorobut-3-enyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 350.8ºC at 760 mmHg |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.65700 |
| Flash Point | 165.9ºC |
| Exact Mass | 210.04500 |
| PSA | 37.30000 |
| LogP | 3.06990 |
| Index of Refraction | 1.561 |
| InChIKey | OLJUVUIQGNJNKM-UHFFFAOYSA-N |
| SMILES | C=C(Cl)CCc1cccc(C(=O)O)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(3-chloro-3-butenyl)benzoic acid |