1-Acetamido-4-hydroxyanthraquinone structure
|
Common Name | 1-Acetamido-4-hydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 7323-62-8 | Molecular Weight | 281.263 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 577.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H11NO4 | Melting Point | 198ºC | |
| MSDS | N/A | Flash Point | 302.9±30.1 °C | |
| Name | 1-Acetamido-4-hydroxyanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 577.2±50.0 °C at 760 mmHg |
| Melting Point | 198ºC |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.263 |
| Flash Point | 302.9±30.1 °C |
| Exact Mass | 281.068817 |
| PSA | 83.47000 |
| LogP | 2.83 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | VPZXLTVIBKOBRG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2924299090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-hydroxy-9,10-dioxoanthracen-1-yl)acetamide |
| N-(4-Hydroxy-9,10-dioxo-9,10-dihydro-1-anthracenyl)acetamide |
| N-(4-Hydroxy-9,10-dioxo-9,10-dihydroanthracen-1-yl)acetamide |